Question
Why benzoic acid is less soluble in water than acetic acid?

Answer

Due to polar nature of the $C = O$ and $O - H$ parts of COOH group, both $CH _3 COOH$ and $C _6 H _5 COOH$ from H -bonds with water. But due to large hydrocarbon part the extent of H -bonding is much lower in benzoic acid than acetic acid and hence benzoic acid is much less soluble in water than acetic acid.

Need a full question paper?

Generate a complete, print-ready paper with questions like this in minutes — across 16+ boards, with answer keys.

Start Generating Free

Similar questions

Read the given passage and answer the questions number 1 to 5 that follow:
The substitution reaction of alkyl halide mainly occurs by SN1 or SN2 mechanism. Whatever mechanism alkyl halides follow for the substitution reaction to occur, the polarity of the carbon halogen bond is responsible for these substitution reactions. The rate of SN1 reactions are governed by the stability of carbocation whereas for SN2 reactions steric factor is the deciding factor. If the starting material is a chiral compound, we may end up with an inverted product or racemic mixture depending upon the type of mechanism followed by alkyl halide. Cleavage of ethers with HI is also governed by steric factor and stability of carbocation, which indicates that in organic chemistry, these two major factors help us in deciding the kind of product formed.
Predict the stereochemistry of the product formed if an optically active alkyl halide undergoes substitution reaction by SN1 mechanism.
Given the standard electrode potentials,
K+/K = –2.93V, Ag+/Ag = 0.80V,
Hg2+/Hg = 0.79V
Mg2+/Mg = –2.37 V, Cr3+/Cr = –0.74V
Arrange these metals in their increasing order of reducing power.
Explain reason that aqueous solution of alcohol is bad conductor of electricity.
What is the effect of dilution on molar conductance?
What is meant by the term. Give an example of the reaction :
Acetal
Write balanced equations for the following : (i) NaCl is heated with sulphuric acid in the presence of $MnO _2$, (ii) Chlorine gas is passed into a solution of NaI in water.
Write Electronic configuration of First transition metal : Ti
Name the following compound according to IUPAC system of nomenclature:

CH3CH(CH3)CH2C(CH3)2COCH3

Arrange $ F_2, Cl_2, Br_2 $ and $ I_2 $ in the increasing order of electron affinities.
What is electrode potential?