Download App

Biomolecules — Chemistry STD 12 Science — Question

Gujarat BoardEnglish MediumSTD 12 ScienceChemistryBiomolecules1 Mark
Question
Why are carbohydrates generally optically active?
✓

Answer

Carbohydrates have chiral or asymmetric carbon atom.

Need a full question paper?

Generate a complete, print-ready paper with questions like this in minutes — across 16+ boards, with answer keys.

Start Generating Free

Explore more

More "1 Marks Question" from Biomolecules→Biomolecules — all question types→Chemistry STD 12 Science question papers→Gujarat Board STD 12 Science question papers→Gujarat Board question paper generator→

Similar questions

Amongst the following compounds, identify which are insoluble, partially soluble and highly soluble in water?
  1. phenol.
  2. toluene.
  3. formic acid.
  4. ethylene glycol.
  5. chloroform.
  6. pentanol.
→
What is electrode potential?
→
Complete the following reaction :
Image
→
Arrange the following in increasing order of their basic strength:
CH3NH2, (CH3)2NH, (CH3)3N, C6H5NH2, C6H5CH2NH2
→
Write the structure of product of the following reaction;

$\text{H}_3\text{C}-\text{C}\equiv\text{C}-\text{H}\ \ \ \ \xrightarrow{\text{Hg}^{2+},\text{ H}_2\text{SO}_4}$

→
Use Hund’s rule to derive the electronic configuration of Ce3+ ion, and calculate its magnetic moment on the basis of ‘spin-only’ formula.
→
Explain why is ortho nitrophenol more acidic than ortho methoxyphenol?
→
Name the following compound according to IUPAC system of nomenclature:

CH3CH(CH3)CH2C(CH3)2COCH3

→
Arrange the following compound in increasing order of their reactivity in nucleophilic addition reaction.

Benzaldehyde, p-Tolualdehyde, p-Nitrob.

→
Note: In the following questions a statement of assertion followed by a statement of reason is given. Choose the correct answer out of the following choices.
  1. Assertion and reason both are correct statements and reason is correct explanation for assertion.
  2. Assertion and reason both are correct statements but reason is not correct explanation for assertion.
  3. Assertion is correct statement but reason is wrong statement.
  4. Assertion and reason both are incorrect statements.
  5. Assertion is wrong statement but reason is correct statement.
Assertion: When NaCl is added to water a depression in freezing point is observed.
Reason: The lowering of vapour pressure of a solution causes depression in the freezing point.
→